C17H24N4O6 — CID 175477848
(Z)-but-2-enedioic acid;1-hexyl-3,7-dimethylpurine-2,6-dione (PubChem CID 175477848) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-hexyl-3,7-dimethylpurine-2,6-dione.
| Compound Name | (Z)-but-2-enedioic acid;1-hexyl-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 175477848 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-hexyl-3,7-dimethylpurine-2,6-dione |
| SMILES | CCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H20N4O2.C4H4O4/c1-4-5-6-7-8-17-12(18)10-11(14-9-15(10)2)16(3)13(17)19;5-3(6)1-2-4(7)8/h9H,4-8H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YYPCNXUFYIOHHY-BTJKTKAUSA-N |
| XLogP | 0.73 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|