C20H34N4O3 — CID 18694216
3,7-dimethyl-1-non-8-enylpurine-2,6-dione;ethoxyethane (PubChem CID 18694216) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is 3,7-dimethyl-1-non-8-enylpurine-2,6-dione;ethoxyethane.
| Compound Name | 3,7-dimethyl-1-non-8-enylpurine-2,6-dione;ethoxyethane |
|---|---|
| PubChem CID | 18694216 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 3,7-dimethyl-1-non-8-enylpurine-2,6-dione;ethoxyethane |
| SMILES | C=CCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O.CCOCC |
| InChI | InChI=1S/C16H24N4O2.C4H10O/c1-4-5-6-7-8-9-10-11-20-15(21)13-14(17-12-18(13)2)19(3)16(20)22;1-3-5-4-2/h4,12H,1,5-11H2,2-3H3;3-4H2,1-2H3 |
| InChIKey | NTLANEQJRZZLHT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|