C16H24Cl2N4O2 — CID 14416834
1,3-bis(5-chloropentyl)-7-methylpurine-2,6-dione (PubChem CID 14416834) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 1,3-bis(5-chloropentyl)-7-methylpurine-2,6-dione.
| Compound Name | 1,3-bis(5-chloropentyl)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 14416834 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1,3-bis(5-chloropentyl)-7-methylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCCCCl)c(=O)n2CCCCCCl |
| InChI | InChI=1S/C16H24Cl2N4O2/c1-20-12-19-14-13(20)15(23)22(11-7-3-5-9-18)16(24)21(14)10-6-2-4-8-17/h12H,2-11H2,1H3 |
| InChIKey | QBABRXKYNRGNBH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|