C18H28N4O3 — CID 15885496
3,7-dimethyl-1-[9-(oxiran-2-yl)nonyl]purine-2,6-dione (PubChem CID 15885496) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3,7-dimethyl-1-[9-(oxiran-2-yl)nonyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[9-(oxiran-2-yl)nonyl]purine-2,6-dione |
|---|---|
| PubChem CID | 15885496 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3,7-dimethyl-1-[9-(oxiran-2-yl)nonyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCCCCCCCC1CO1)c(=O)n2C |
| InChI | InChI=1S/C18H28N4O3/c1-20-13-19-16-15(20)17(23)22(18(24)21(16)2)11-9-7-5-3-4-6-8-10-14-12-25-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | UYMUSANDBGGFGJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|