C12H16N4O3 — CID 54391228
3,7-dimethyl-1-[3-(oxiran-2-yl)propyl]purine-2,6-dione (PubChem CID 54391228) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3,7-dimethyl-1-[3-(oxiran-2-yl)propyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[3-(oxiran-2-yl)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54391228 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3,7-dimethyl-1-[3-(oxiran-2-yl)propyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCC1CO1)c(=O)n2C |
| InChI | InChI=1S/C12H16N4O3/c1-14-7-13-10-9(14)11(17)16(12(18)15(10)2)5-3-4-8-6-19-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | VGTXRKNBOILFNX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 74.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|