C15H20N4O3 — CID 121279345
3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]purine-2,6-dione (PubChem CID 121279345) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 121279345 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCC1CCC(=O)CC1)c(=O)n2C |
| InChI | InChI=1S/C15H20N4O3/c1-17-9-16-13-12(17)14(21)19(15(22)18(13)2)8-7-10-3-5-11(20)6-4-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | UJOXTLZKFFDLQC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |