C16H24N4O2 — CID 54050333
3,7-dimethyl-1-non-6-enylpurine-2,6-dione (PubChem CID 54050333) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3,7-dimethyl-1-non-6-enylpurine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-non-6-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 54050333 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3,7-dimethyl-1-non-6-enylpurine-2,6-dione |
| SMILES | CCC=CCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C16H24N4O2/c1-4-5-6-7-8-9-10-11-20-15(21)13-14(17-12-18(13)2)19(3)16(20)22/h5-6,12H,4,7-11H2,1-3H3 |
| InChIKey | LSLDJLFVIWMJJL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|