About 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione
1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 139678925) has the molecular formula C19H32N4O3
and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione |
| PubChem CID | 139678925 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CCCC(O)CCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C19H32N4O3/c1-4-11-15(24)12-9-7-5-6-8-10-13-23-18(25)16-17(20-14-21(16)2)22(3)19(23)26/h14-15,24H,4-13H2,1-3H3 |
| InChIKey | YGEOPYLNFFOHHR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione?
The IUPAC name of 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione (CID 139678925) is 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione.
What is the SMILES notation for 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione?
The canonical SMILES for 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione is CCCC(O)CCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O.
What is the InChIKey of 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione?
The InChIKey is YGEOPYLNFFOHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4O3/c1-4-11-15(24)12-9-7-5-6-8-10-13-23-18(25)16-17(20-14-21(16)2)22(3)19(23)26/h14-15,24H,4-13H2,1-3H3.
What are the key properties of 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione?
1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione has a molecular weight of 364.49 g/mol, XLogP of 2.33, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-hydroxydodecyl)-3,7-dimethylpurine-2,6-dione is sourced from PubChem (CID 139678925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).