C26H45N5O4 — CID 18975568
N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-hexylacetamide (PubChem CID 18975568) has the molecular formula C26H45N5O4 and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-hexylacetamide.
| Compound Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 18975568 |
| Molecular Formula | C26H45N5O4 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | N-[11-(3,7-dimethyl-2,6-dioxopurin-1-yl)-2-hydroxyundecyl]-N-hexylacetamide |
| SMILES | CCCCCCN(CC(O)CCCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O)C(C)=O |
| InChI | InChI=1S/C26H45N5O4/c1-5-6-7-14-17-30(21(2)32)19-22(33)16-13-11-9-8-10-12-15-18-31-25(34)23-24(27-20-28(23)3)29(4)26(31)35/h20,22,33H,5-19H2,1-4H3 |
| InChIKey | MCMRPPGFXPIFSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|