C13H20N4O4 — CID 154733528
1-[(5S)-5,6-dihydroxyhexyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 154733528) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[(5S)-5,6-dihydroxyhexyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(5S)-5,6-dihydroxyhexyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 154733528 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[(5S)-5,6-dihydroxyhexyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCC[C@H](O)CO)c(=O)n2C |
| InChI | InChI=1S/C13H20N4O4/c1-15-8-14-11-10(15)12(20)17(13(21)16(11)2)6-4-3-5-9(19)7-18/h8-9,18-19H,3-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | XMTDKFOBRLKELE-VIFPVBQESA-N |
| XLogP | -1.04 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|