C13H20N4O4 — CID 153085871
1-(4,4-dideuterio-5,5-dihydroxyhexyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 153085871) has the molecular formula C13H20N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(4,4-dideuterio-5,5-dihydroxyhexyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-(4,4-dideuterio-5,5-dihydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 153085871 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-(4,4-dideuterio-5,5-dihydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | [2H]C([2H])(CCCn1c(=O)c2c(ncn2C)n(C)c1=O)C(C)(O)O |
| InChI | InChI=1S/C13H20N4O4/c1-13(20,21)6-4-5-7-17-11(18)9-10(14-8-15(9)2)16(3)12(17)19/h8,20-21H,4-7H2,1-3H3/i6D2 |
| InChIKey | VOEVTSIXCKGICY-NCYHJHSESA-N |
| XLogP | -0.70 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|