C18H30N4O4 — CID 22941883
1-[(4S)-7,8-dihydroxy-4,8-dimethylnonyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 22941883) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[(4S)-7,8-dihydroxy-4,8-dimethylnonyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(4S)-7,8-dihydroxy-4,8-dimethylnonyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22941883 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[(4S)-7,8-dihydroxy-4,8-dimethylnonyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | C[C@@H](CCCn1c(=O)c2c(ncn2C)n(C)c1=O)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C18H30N4O4/c1-12(8-9-13(23)18(2,3)26)7-6-10-22-16(24)14-15(19-11-20(14)4)21(5)17(22)25/h11-13,23,26H,6-10H2,1-5H3/t12-,13?/m0/s1 |
| InChIKey | LFBNUOZEQDEJHX-UEWDXFNNSA-N |
| XLogP | 0.76 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |