C17H26N4O2 — CID 22861485
1-[(3S)-3,7-dimethyloct-6-enyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 22861485) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(3S)-3,7-dimethyloct-6-enyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(3S)-3,7-dimethyloct-6-enyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22861485 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[(3S)-3,7-dimethyloct-6-enyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(C)=CCC[C@H](C)CCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C17H26N4O2/c1-12(2)7-6-8-13(3)9-10-21-16(22)14-15(18-11-19(14)4)20(5)17(21)23/h7,11,13H,6,8-10H2,1-5H3/t13-/m0/s1 |
| InChIKey | GLSQZRIALOVKTP-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|