C12H19N5O3 — CID 121279243
1-[2-(2-hydroxypropylamino)ethyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 121279243) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-[2-(2-hydroxypropylamino)ethyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[2-(2-hydroxypropylamino)ethyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 121279243 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[2-(2-hydroxypropylamino)ethyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(O)CNCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C12H19N5O3/c1-8(18)6-13-4-5-17-11(19)9-10(14-7-15(9)2)16(3)12(17)20/h7-8,13,18H,4-6H2,1-3H3 |
| InChIKey | AABRBYABIFUFPP-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|