C16H19N5O2 — CID 154174612
1-[2-(benzylamino)ethyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 154174612) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-[2-(benzylamino)ethyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[2-(benzylamino)ethyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 154174612 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[2-(benzylamino)ethyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCNCc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C16H19N5O2/c1-19-11-18-14-13(19)15(22)21(16(23)20(14)2)9-8-17-10-12-6-4-3-5-7-12/h3-7,11,17H,8-10H2,1-2H3 |
| InChIKey | LDPBZXGLMGLKRW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|