C16H20ClN5O2 — CID 110174096
(3,7-dimethyl-2,6-dioxopurin-1-yl)methyl-(2-phenylethyl)azanium chloride (PubChem CID 110174096) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is (3,7-dimethyl-2,6-dioxopurin-1-yl)methyl-(2-phenylethyl)azanium chloride.
| Compound Name | (3,7-dimethyl-2,6-dioxopurin-1-yl)methyl-(2-phenylethyl)azanium chloride |
|---|---|
| PubChem CID | 110174096 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (3,7-dimethyl-2,6-dioxopurin-1-yl)methyl-(2-phenylethyl)azanium chloride |
| SMILES | Cn1cnc2c1c(=O)n(C[NH2+]CCc1ccccc1)c(=O)n2C.[Cl-] |
| InChI | InChI=1S/C16H19N5O2.ClH/c1-19-11-18-14-13(19)15(22)21(16(23)20(14)2)10-17-9-8-12-6-4-3-5-7-12;/h3-7,11,17H,8-10H2,1-2H3;1H |
| InChIKey | YYDBHVZHPNHFPH-UHFFFAOYSA-N |
| XLogP | -3.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|