C14H14N4O2 — CID 163811964
9-benzyl-1,7-dimethylpurine-6,8-dione (PubChem CID 163811964) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 9-benzyl-1,7-dimethylpurine-6,8-dione.
| Compound Name | 9-benzyl-1,7-dimethylpurine-6,8-dione |
|---|---|
| PubChem CID | 163811964 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 9-benzyl-1,7-dimethylpurine-6,8-dione |
| SMILES | Cn1cnc2c(c1=O)n(C)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C14H14N4O2/c1-16-9-15-12-11(13(16)19)17(2)14(20)18(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | YNJPSFAHJWKNBH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |