C21H30N4O3 — CID 142022461
7-benzyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione;ethane (PubChem CID 142022461) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 7-benzyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione;ethane.
| Compound Name | 7-benzyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione;ethane |
|---|---|
| PubChem CID | 142022461 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 7-benzyl-1-(5-hydroxyhexyl)-3-methylpurine-2,6-dione;ethane |
| SMILES | CC.CC(O)CCCCn1c(=O)c2c(ncn2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C19H24N4O3.C2H6/c1-14(24)8-6-7-11-23-18(25)16-17(21(2)19(23)26)20-13-22(16)12-15-9-4-3-5-10-15;1-2/h3-5,9-10,13-14,24H,6-8,11-12H2,1-2H3;1-2H3 |
| InChIKey | QKPSMQKEZFAWLV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|