C20H26FN5O3 — CID 24816082
8-[(3-fluorophenyl)methylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 24816082) has the molecular formula C20H26FN5O3 and a molecular weight of 403.46 g/mol. Its IUPAC name is 8-[(3-fluorophenyl)methylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[(3-fluorophenyl)methylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 24816082 |
| Molecular Formula | C20H26FN5O3 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 8-[(3-fluorophenyl)methylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(O)CCCCn1c(=O)c2c(nc(NCc3cccc(F)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C20H26FN5O3/c1-13(27)7-4-5-10-26-18(28)16-17(25(3)20(26)29)23-19(24(16)2)22-12-14-8-6-9-15(21)11-14/h6,8-9,11,13,27H,4-5,7,10,12H2,1-3H3,(H,22,23) |
| InChIKey | BJYIGSCKNMSOCZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|