C23H42N6O6 — CID 11576919
8-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 11576919) has the molecular formula C23H42N6O6 and a molecular weight of 498.63 g/mol. Its IUPAC name is 8-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 11576919 |
| Molecular Formula | C23H42N6O6 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 8-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]-1-(5-hydroxyhexyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(O)CCCCn1c(=O)c2c(nc(NCCCOCCOCCOCCCN)n2C)n(C)c1=O |
| InChI | InChI=1S/C23H42N6O6/c1-18(30)8-4-5-11-29-21(31)19-20(28(3)23(29)32)26-22(27(19)2)25-10-7-13-34-15-17-35-16-14-33-12-6-9-24/h18,30H,4-17,24H2,1-3H3,(H,25,26) |
| InChIKey | AQIZASVHWRJELP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 147.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|