C13H22N6O2 — CID 82463924
8-(2-aminoethylamino)-7-butyl-1,3-dimethylpurine-2,6-dione (PubChem CID 82463924) has the molecular formula C13H22N6O2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-7-butyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-aminoethylamino)-7-butyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82463924 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 8-(2-aminoethylamino)-7-butyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCn1c(NCCN)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H22N6O2/c1-4-5-8-19-9-10(16-12(19)15-7-6-14)17(2)13(21)18(3)11(9)20/h4-8,14H2,1-3H3,(H,15,16) |
| InChIKey | IJNIWWSILICSBG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |