C18H33N5O2 — CID 20562678
7-butyl-1,3,8-trimethylpurine-2,6-dione;N-propylpropan-1-amine (PubChem CID 20562678) has the molecular formula C18H33N5O2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 7-butyl-1,3,8-trimethylpurine-2,6-dione;N-propylpropan-1-amine.
| Compound Name | 7-butyl-1,3,8-trimethylpurine-2,6-dione;N-propylpropan-1-amine |
|---|---|
| PubChem CID | 20562678 |
| Molecular Formula | C18H33N5O2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 7-butyl-1,3,8-trimethylpurine-2,6-dione;N-propylpropan-1-amine |
| SMILES | CCCCn1c(C)nc2c1c(=O)n(C)c(=O)n2C.CCCNCCC |
| InChI | InChI=1S/C12H18N4O2.C6H15N/c1-5-6-7-16-8(2)13-10-9(16)11(17)15(4)12(18)14(10)3;1-3-5-7-6-4-2/h5-7H2,1-4H3;7H,3-6H2,1-2H3 |
| InChIKey | VJMSTIJQAHABAS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|