C12H21N5O2 — CID 20562628
7-ethyl-1,3,8-trimethylpurine-2,6-dione;N-methylmethanamine (PubChem CID 20562628) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 7-ethyl-1,3,8-trimethylpurine-2,6-dione;N-methylmethanamine.
| Compound Name | 7-ethyl-1,3,8-trimethylpurine-2,6-dione;N-methylmethanamine |
|---|---|
| PubChem CID | 20562628 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 7-ethyl-1,3,8-trimethylpurine-2,6-dione;N-methylmethanamine |
| SMILES | CCn1c(C)nc2c1c(=O)n(C)c(=O)n2C.CNC |
| InChI | InChI=1S/C10H14N4O2.C2H7N/c1-5-14-6(2)11-8-7(14)9(15)13(4)10(16)12(8)3;1-3-2/h5H2,1-4H3;3H,1-2H3 |
| InChIKey | FPFHGQXCZNFVGM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |