C10H15N5O2 — CID 719396
7-ethyl-1,3-dimethyl-8-(methylamino)purine-2,6-dione (PubChem CID 719396) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-(methylamino)purine-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-(methylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 719396 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-(methylamino)purine-2,6-dione |
| SMILES | CCn1c(NC)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H15N5O2/c1-5-15-6-7(12-9(15)11-2)13(3)10(17)14(4)8(6)16/h5H2,1-4H3,(H,11,12) |
| InChIKey | YEXVWWBNIQFHJT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |