C9H15N7O2 — CID 12506348
7-(2-aminoethyl)-8-hydrazinyl-1,3-dimethylpurine-2,6-dione (PubChem CID 12506348) has the molecular formula C9H15N7O2 and a molecular weight of 253.27 g/mol. Its IUPAC name is 7-(2-aminoethyl)-8-hydrazinyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(2-aminoethyl)-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 12506348 |
| Molecular Formula | C9H15N7O2 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7-(2-aminoethyl)-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NN)n2CCN)n(C)c1=O |
| InChI | InChI=1S/C9H15N7O2/c1-14-6-5(7(17)15(2)9(14)18)16(4-3-10)8(12-6)13-11/h3-4,10-11H2,1-2H3,(H,12,13) |
| InChIKey | IOZLIDDPQJKDAU-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|