C16H21ClN10O4 — CID 135379902
8-chloro-1,3,7-trimethylpurine-2,6-dione;8-hydrazinyl-1,3,7-trimethylpurine-2,6-dione (PubChem CID 135379902) has the molecular formula C16H21ClN10O4 and a molecular weight of 452.86 g/mol. Its IUPAC name is 8-chloro-1,3,7-trimethylpurine-2,6-dione;8-hydrazinyl-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-chloro-1,3,7-trimethylpurine-2,6-dione;8-hydrazinyl-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 135379902 |
| Molecular Formula | C16H21ClN10O4 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 8-chloro-1,3,7-trimethylpurine-2,6-dione;8-hydrazinyl-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2C)n(C)c1=O.Cn1c(=O)c2c(nc(NN)n2C)n(C)c1=O |
| InChI | InChI=1S/C8H9ClN4O2.C8H12N6O2/c1-11-4-5(10-7(11)9)12(2)8(15)13(3)6(4)14;1-12-4-5(10-7(12)11-9)13(2)8(16)14(3)6(4)15/h1-3H3;9H2,1-3H3,(H,10,11) |
| InChIKey | WYXCTIVNQJJTAN-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 161.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|