C8H10N4O2Pb — CID 173012606
(1,3,7-trimethyl-2,6-dioxopurin-8-yl)-λ2-plumbane (PubChem CID 173012606) has the molecular formula C8H10N4O2Pb and a molecular weight of 401.39 g/mol. Its IUPAC name is (1,3,7-trimethyl-2,6-dioxopurin-8-yl)-λ2-plumbane.
| Compound Name | (1,3,7-trimethyl-2,6-dioxopurin-8-yl)-λ2-plumbane |
|---|---|
| PubChem CID | 173012606 |
| Molecular Formula | C8H10N4O2Pb |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (1,3,7-trimethyl-2,6-dioxopurin-8-yl)-λ2-plumbane |
| SMILES | Cn1c(=O)c2c(nc([PbH])n2C)n(C)c1=O |
| InChI | InChI=1S/C8H9N4O2.Pb.H/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;;/h1-3H3;; |
| InChIKey | WVNOIJRHMBIKND-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |