C9H12N4O4S — CID 940119
1,3,7-trimethyl-8-methylsulfonylpurine-2,6-dione (PubChem CID 940119) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-methylsulfonylpurine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-methylsulfonylpurine-2,6-dione |
|---|---|
| PubChem CID | 940119 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1,3,7-trimethyl-8-methylsulfonylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(S(C)(=O)=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C9H12N4O4S/c1-11-5-6(10-8(11)18(4,16)17)12(2)9(15)13(3)7(5)14/h1-4H3 |
| InChIKey | LITVSIIZRQQKPD-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |