C16H25N5O5S — CID 146370296
N-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)propyl]pentanamide (PubChem CID 146370296) has the molecular formula C16H25N5O5S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)propyl]pentanamide.
| Compound Name | N-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 146370296 |
| Molecular Formula | C16H25N5O5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)propyl]pentanamide |
| SMILES | CCCCC(=O)NCCCn1c(=O)n(C)c(=O)c2c1nc(S(C)(=O)=O)n2C |
| InChI | InChI=1S/C16H25N5O5S/c1-5-6-8-11(22)17-9-7-10-21-13-12(14(23)20(3)16(21)24)19(2)15(18-13)27(4,25)26/h5-10H2,1-4H3,(H,17,22) |
| InChIKey | ZMEWYJSYEGXMBL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|