C11H12N4O4S — CID 146282996
3,7-dimethyl-8-methylsulfonyl-1-prop-2-ynylpurine-2,6-dione (PubChem CID 146282996) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3,7-dimethyl-8-methylsulfonyl-1-prop-2-ynylpurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-methylsulfonyl-1-prop-2-ynylpurine-2,6-dione |
|---|---|
| PubChem CID | 146282996 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3,7-dimethyl-8-methylsulfonyl-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(S(C)(=O)=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C11H12N4O4S/c1-5-6-15-9(16)7-8(14(3)11(15)17)12-10(13(7)2)20(4,18)19/h1H,6H2,2-4H3 |
| InChIKey | UWJDRAIOZFJLHT-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|