C19H19N5O5S — CID 146283134
N-[3-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)prop-1-ynyl]phenyl]acetamide (PubChem CID 146283134) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[3-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)prop-1-ynyl]phenyl]acetamide.
| Compound Name | N-[3-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)prop-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 146283134 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-[3-(1,7-dimethyl-8-methylsulfonyl-2,6-dioxopurin-3-yl)prop-1-ynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C#CCn2c(=O)n(C)c(=O)c3c2nc(S(C)(=O)=O)n3C)c1 |
| InChI | InChI=1S/C19H19N5O5S/c1-12(25)20-14-9-5-7-13(11-14)8-6-10-24-16-15(17(26)23(3)19(24)27)22(2)18(21-16)30(4,28)29/h5,7,9,11H,10H2,1-4H3,(H,20,25) |
| InChIKey | HBJZAVUBKFWQCQ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|