C21H21N5O6S — CID 146283065
N-[3-[3-[8-(2-hydroxyethylsulfonyl)-1,7-dimethyl-2,6-dioxopurin-3-yl]prop-1-ynyl]phenyl]prop-2-enamide (PubChem CID 146283065) has the molecular formula C21H21N5O6S and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[3-[3-[8-(2-hydroxyethylsulfonyl)-1,7-dimethyl-2,6-dioxopurin-3-yl]prop-1-ynyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-[8-(2-hydroxyethylsulfonyl)-1,7-dimethyl-2,6-dioxopurin-3-yl]prop-1-ynyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146283065 |
| Molecular Formula | C21H21N5O6S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[3-[3-[8-(2-hydroxyethylsulfonyl)-1,7-dimethyl-2,6-dioxopurin-3-yl]prop-1-ynyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C#CCn2c(=O)n(C)c(=O)c3c2nc(S(=O)(=O)CCO)n3C)c1 |
| InChI | InChI=1S/C21H21N5O6S/c1-4-16(28)22-15-9-5-7-14(13-15)8-6-10-26-18-17(19(29)25(3)21(26)30)24(2)20(23-18)33(31,32)12-11-27/h4-5,7,9,13,27H,1,10-12H2,2-3H3,(H,22,28) |
| InChIKey | IHEDLNSGLPENFB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|