C16H15N5O5S — CID 146283110
3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethyl-2,6-dioxopurine-8-sulfonamide (PubChem CID 146283110) has the molecular formula C16H15N5O5S and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethyl-2,6-dioxopurine-8-sulfonamide.
| Compound Name | 3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethyl-2,6-dioxopurine-8-sulfonamide |
|---|---|
| PubChem CID | 146283110 |
| Molecular Formula | C16H15N5O5S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethyl-2,6-dioxopurine-8-sulfonamide |
| SMILES | Cn1c(=O)c2c(nc(S(N)(=O)=O)n2C)n(CC#Cc2cccc(O)c2)c1=O |
| InChI | InChI=1S/C16H15N5O5S/c1-19-12-13(18-15(19)27(17,25)26)21(16(24)20(2)14(12)23)8-4-6-10-5-3-7-11(22)9-10/h3,5,7,9,22H,8H2,1-2H3,(H2,17,25,26) |
| InChIKey | BJGPKTIDIAVZSH-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|