C18H18N4O4 — CID 174324078
N-[4-[3-(3-hydroxyphenyl)prop-2-ynylamino]-1,3-dimethyl-2,6-dioxopyrimidin-5-yl]prop-2-enamide (PubChem CID 174324078) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[4-[3-(3-hydroxyphenyl)prop-2-ynylamino]-1,3-dimethyl-2,6-dioxopyrimidin-5-yl]prop-2-enamide.
| Compound Name | N-[4-[3-(3-hydroxyphenyl)prop-2-ynylamino]-1,3-dimethyl-2,6-dioxopyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174324078 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[4-[3-(3-hydroxyphenyl)prop-2-ynylamino]-1,3-dimethyl-2,6-dioxopyrimidin-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(NCC#Cc2cccc(O)c2)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H18N4O4/c1-4-14(24)20-15-16(21(2)18(26)22(3)17(15)25)19-10-6-8-12-7-5-9-13(23)11-12/h4-5,7,9,11,19,23H,1,10H2,2-3H3,(H,20,24) |
| InChIKey | NOFVRFLMLIBCGE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|