C18H16ClN3O3 — CID 174324067
N-[4-chloro-1-methyl-2,6-dioxo-3-(3-phenylprop-2-ynyl)pyrimidin-5-yl]-N-methylprop-2-enamide (PubChem CID 174324067) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-[4-chloro-1-methyl-2,6-dioxo-3-(3-phenylprop-2-ynyl)pyrimidin-5-yl]-N-methylprop-2-enamide.
| Compound Name | N-[4-chloro-1-methyl-2,6-dioxo-3-(3-phenylprop-2-ynyl)pyrimidin-5-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 174324067 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[4-chloro-1-methyl-2,6-dioxo-3-(3-phenylprop-2-ynyl)pyrimidin-5-yl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1c(Cl)n(CC#Cc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H16ClN3O3/c1-4-14(23)20(2)15-16(19)22(18(25)21(3)17(15)24)12-8-11-13-9-6-5-7-10-13/h4-7,9-10H,1,12H2,2-3H3 |
| InChIKey | UGYIZIICILMGPN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|