C24H23N3O2 — CID 22509098
3-benzyl-1-methyl-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 22509098) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-benzyl-1-methyl-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1-methyl-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22509098 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-benzyl-1-methyl-6-(3-phenylprop-2-ynyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c2c(c(=O)n(Cc3ccccc3)c1=O)CN(CC#Cc1ccccc1)CC2 |
| InChI | InChI=1S/C24H23N3O2/c1-25-22-14-16-26(15-8-13-19-9-4-2-5-10-19)18-21(22)23(28)27(24(25)29)17-20-11-6-3-7-12-20/h2-7,9-12H,14-18H2,1H3 |
| InChIKey | OKMKAFFMOOUIDU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|