C23H20ClN3O — CID 22509061
3-benzyl-6-[3-(4-chlorophenyl)prop-2-ynyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 22509061) has the molecular formula C23H20ClN3O and a molecular weight of 389.89 g/mol. Its IUPAC name is 3-benzyl-6-[3-(4-chlorophenyl)prop-2-ynyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-6-[3-(4-chlorophenyl)prop-2-ynyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 22509061 |
| Molecular Formula | C23H20ClN3O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-benzyl-6-[3-(4-chlorophenyl)prop-2-ynyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(ncn1Cc1ccccc1)CCN(CC#Cc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C23H20ClN3O/c24-20-10-8-18(9-11-20)7-4-13-26-14-12-22-21(16-26)23(28)27(17-25-22)15-19-5-2-1-3-6-19/h1-3,5-6,8-11,17H,12-16H2 |
| InChIKey | QXYIAMSFASXZRI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|