C18H14ClN3O4 — CID 174323753
N-[6-chloro-1-[3-(3-hydroxyphenyl)prop-2-ynyl]-3-methyl-2,4-dioxopyrimidin-5-yl]but-2-ynamide (PubChem CID 174323753) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is N-[6-chloro-1-[3-(3-hydroxyphenyl)prop-2-ynyl]-3-methyl-2,4-dioxopyrimidin-5-yl]but-2-ynamide.
| Compound Name | N-[6-chloro-1-[3-(3-hydroxyphenyl)prop-2-ynyl]-3-methyl-2,4-dioxopyrimidin-5-yl]but-2-ynamide |
|---|---|
| PubChem CID | 174323753 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[6-chloro-1-[3-(3-hydroxyphenyl)prop-2-ynyl]-3-methyl-2,4-dioxopyrimidin-5-yl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1c(Cl)n(CC#Cc2cccc(O)c2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C18H14ClN3O4/c1-3-6-14(24)20-15-16(19)22(18(26)21(2)17(15)25)10-5-8-12-7-4-9-13(23)11-12/h4,7,9,11,23H,10H2,1-2H3,(H,20,24) |
| InChIKey | PYIBBMLRVMUIHS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|