C18H18N4O6S — CID 146283118
8-(2-hydroxyethylsulfonyl)-3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethylpurine-2,6-dione (PubChem CID 146283118) has the molecular formula C18H18N4O6S and a molecular weight of 418.43 g/mol. Its IUPAC name is 8-(2-hydroxyethylsulfonyl)-3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-hydroxyethylsulfonyl)-3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 146283118 |
| Molecular Formula | C18H18N4O6S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 8-(2-hydroxyethylsulfonyl)-3-[3-(3-hydroxyphenyl)prop-2-ynyl]-1,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(S(=O)(=O)CCO)n2C)n(CC#Cc2cccc(O)c2)c1=O |
| InChI | InChI=1S/C18H18N4O6S/c1-20-14-15(19-17(20)29(27,28)10-9-23)22(18(26)21(2)16(14)25)8-4-6-12-5-3-7-13(24)11-12/h3,5,7,11,23-24H,8-10H2,1-2H3 |
| InChIKey | GYZZLTUXYRVWIL-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|