C19H19N5O4S — CID 146283050
3-[3-(2,3-dihydro-1H-indol-6-yl)prop-2-ynyl]-1,7-dimethyl-8-methylsulfonylpurine-2,6-dione (PubChem CID 146283050) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1H-indol-6-yl)prop-2-ynyl]-1,7-dimethyl-8-methylsulfonylpurine-2,6-dione.
| Compound Name | 3-[3-(2,3-dihydro-1H-indol-6-yl)prop-2-ynyl]-1,7-dimethyl-8-methylsulfonylpurine-2,6-dione |
|---|---|
| PubChem CID | 146283050 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-[3-(2,3-dihydro-1H-indol-6-yl)prop-2-ynyl]-1,7-dimethyl-8-methylsulfonylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(S(C)(=O)=O)n2C)n(CC#Cc2ccc3c(c2)NCC3)c1=O |
| InChI | InChI=1S/C19H19N5O4S/c1-22-15-16(21-18(22)29(3,27)28)24(19(26)23(2)17(15)25)10-4-5-12-6-7-13-8-9-20-14(13)11-12/h6-7,11,20H,8-10H2,1-3H3 |
| InChIKey | SBVVWLJQRZHXMB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|