C16H15N5O4S — CID 146282991
4-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfonylmethyl]benzonitrile (PubChem CID 146282991) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfonylmethyl]benzonitrile.
| Compound Name | 4-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 146282991 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfonylmethyl]benzonitrile |
| SMILES | Cn1c(=O)c2c(nc(S(=O)(=O)Cc3ccc(C#N)cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H15N5O4S/c1-19-12-13(20(2)16(23)21(3)14(12)22)18-15(19)26(24,25)9-11-6-4-10(8-17)5-7-11/h4-7H,9H2,1-3H3 |
| InChIKey | GTRMVKVEBJBHJU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 119.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |