C15H16N4O4 — CID 70429632
8-[(3,4-dihydroxyphenyl)methyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 70429632) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 8-[(3,4-dihydroxyphenyl)methyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(3,4-dihydroxyphenyl)methyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70429632 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 8-[(3,4-dihydroxyphenyl)methyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cc3ccc(O)c(O)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C15H16N4O4/c1-17-11(7-8-4-5-9(20)10(21)6-8)16-13-12(17)14(22)19(3)15(23)18(13)2/h4-6,20-21H,7H2,1-3H3 |
| InChIKey | KXBSTUMFYGFBHR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|