C16H17BrN4O2S — CID 70684855
8-[2-(4-bromophenyl)sulfanylethyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 70684855) has the molecular formula C16H17BrN4O2S and a molecular weight of 409.31 g/mol. Its IUPAC name is 8-[2-(4-bromophenyl)sulfanylethyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-(4-bromophenyl)sulfanylethyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70684855 |
| Molecular Formula | C16H17BrN4O2S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 8-[2-(4-bromophenyl)sulfanylethyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(CCSc3ccc(Br)cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H17BrN4O2S/c1-19-12(8-9-24-11-6-4-10(17)5-7-11)18-14-13(19)15(22)21(3)16(23)20(14)2/h4-7H,8-9H2,1-3H3 |
| InChIKey | LMMXETZQNWAPNR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |