C14H12BrClN4O2 — CID 598171
7-[(4-bromophenyl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione (PubChem CID 598171) has the molecular formula C14H12BrClN4O2 and a molecular weight of 383.63 g/mol. Its IUPAC name is 7-[(4-bromophenyl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(4-bromophenyl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 598171 |
| Molecular Formula | C14H12BrClN4O2 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 7-[(4-bromophenyl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2Cc2ccc(Br)cc2)n(C)c1=O |
| InChI | InChI=1S/C14H12BrClN4O2/c1-18-11-10(12(21)19(2)14(18)22)20(13(16)17-11)7-8-3-5-9(15)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | IYMTZTSOTHWRJI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |