C11H10ClN5O2S — CID 166234274
8-chloro-1,3-dimethyl-7-(1,3-thiazol-2-ylmethyl)purine-2,6-dione (PubChem CID 166234274) has the molecular formula C11H10ClN5O2S and a molecular weight of 311.75 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7-(1,3-thiazol-2-ylmethyl)purine-2,6-dione.
| Compound Name | 8-chloro-1,3-dimethyl-7-(1,3-thiazol-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 166234274 |
| Molecular Formula | C11H10ClN5O2S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7-(1,3-thiazol-2-ylmethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2Cc2nccs2)n(C)c1=O |
| InChI | InChI=1S/C11H10ClN5O2S/c1-15-8-7(9(18)16(2)11(15)19)17(10(12)14-8)5-6-13-3-4-20-6/h3-4H,5H2,1-2H3 |
| InChIKey | ZLNSHTGCXYSMCX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |