C16H14ClN7O2 — CID 27912028
7-[(4-aminoquinazolin-2-yl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione (PubChem CID 27912028) has the molecular formula C16H14ClN7O2 and a molecular weight of 371.79 g/mol. Its IUPAC name is 7-[(4-aminoquinazolin-2-yl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(4-aminoquinazolin-2-yl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 27912028 |
| Molecular Formula | C16H14ClN7O2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 7-[(4-aminoquinazolin-2-yl)methyl]-8-chloro-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2Cc2nc(N)c3ccccc3n2)n(C)c1=O |
| InChI | InChI=1S/C16H14ClN7O2/c1-22-13-11(14(25)23(2)16(22)26)24(15(17)21-13)7-10-19-9-6-4-3-5-8(9)12(18)20-10/h3-6H,7H2,1-2H3,(H2,18,19,20) |
| InChIKey | QVYIJDLKXNNIQE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |