C22H20ClN5O3 — CID 24569507
N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide (PubChem CID 24569507) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide.
| Compound Name | N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 24569507 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-benzyl-2-(8-chloro-1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2CC(=O)N(Cc2ccccc2)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C22H20ClN5O3/c1-25-19-18(20(30)26(2)22(25)31)28(21(23)24-19)14-17(29)27(16-11-7-4-8-12-16)13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | ASVVLDVHMYLOFT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |