C19H17ClN4O4 — CID 8018003
8-chloro-7-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 8018003) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is 8-chloro-7-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-chloro-7-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 8018003 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 8-chloro-7-[(7-ethyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCc1ccc2c(Cn3c(Cl)nc4c3c(=O)n(C)c(=O)n4C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H17ClN4O4/c1-4-10-5-6-12-11(8-14(25)28-13(12)7-10)9-24-15-16(21-18(24)20)22(2)19(27)23(3)17(15)26/h5-8H,4,9H2,1-3H3 |
| InChIKey | VILVGZQAKUJJIR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|