C11H14N4O4 — CID 14261748
methyl 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)acetate (PubChem CID 14261748) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is methyl 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)acetate.
| Compound Name | methyl 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)acetate |
|---|---|
| PubChem CID | 14261748 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | methyl 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)acetate |
| SMILES | COC(=O)Cc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C11H14N4O4/c1-13-6(5-7(16)19-4)12-9-8(13)10(17)15(3)11(18)14(9)2/h5H2,1-4H3 |
| InChIKey | SMMMGPKFJZPIRP-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |