C9H12CaN4O4 — CID 173389056
calcium;hydride;1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid (PubChem CID 173389056) has the molecular formula C9H12CaN4O4 and a molecular weight of 280.30 g/mol. Its IUPAC name is calcium;hydride;1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid.
| Compound Name | calcium;hydride;1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid |
|---|---|
| PubChem CID | 173389056 |
| Molecular Formula | C9H12CaN4O4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | calcium;hydride;1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid |
| SMILES | Cn1c(=O)c2c(nc(C(=O)O)n2C)n(C)c1=O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C9H10N4O4.Ca.2H/c1-11-4-5(10-6(11)8(15)16)12(2)9(17)13(3)7(4)14;;;/h1-3H3,(H,15,16);;;/q;+2;2*-1 |
| InChIKey | VEDAUWARMWLUPT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |